General Organic And Biological Chemistry Structures of Life, 5th Edition By Timberlake Test Bank

<< Genetics Analysis and Principles 5th Edition by Brooker Test Bank Human Physiology From Cells To Systems 3rd Edition by Lauralee Sherwood Test Bank >>
Product Code: 222
Availability: In Stock
Price: $24.99
Qty:     - OR -   Add to Wish List
Add to Compare

General Organic And Biological Chemistry Structures of Life, 5th Edition By Timberlake Test Bank

Description

WITH ANSWERS
General Organic And Biological Chemistry Structures of Life, 5th Edition By Timberlake Test Bank

General, Organic & Biological Chemistry, 5e (Timberlake)

Chapter 5   Nuclear Chemistry

 

5.1   Multiple-Choice Questions

 

1) What is the nuclear symbol for a radioactive isotope of copper with a mass number of 60?

  1. A) Cu
  2. B) Cu
  3. C) 29Cu
  4. D) Cu
  5. E) Cu

Answer:  A

Objective:  5.1

Global Outcomes:  GO2

 

2) The nuclear symbol of helium, He, is also the symbol for designating a(n)

  1. A) proton.
  2. B) neutron.
  3. C) gamma ray.
  4. D) beta particle.
  5. E) alpha particle.

Answer:  E

Objective:  5.1

Global Outcomes:  GO2

 

3) The symbol e is a symbol used for a(n)

  1. A) proton.
  2. B) neutron.
  3. C) gamma ray.
  4. D) beta particle.
  5. E) alpha particle.

Answer:  D

Objective:  5.1

Global Outcomes:  GO2

 

4) The symbol e is a symbol used for a(n)

  1. A) proton.
  2. B) positron.
  3. C) gamma ray.
  4. D) beta particle.
  5. E) alpha particle.

Answer:  B

Objective:  5.1

Global Outcomes:  GO2

 

5) A positron is a particle emitted from the nucleus that has the same mass as a(n)

  1. A) electron but has a positive charge.
  2. B) neutron but has a positive charge.
  3. C) alpha particle.
  4. D) beta particle.
  5. E) proton emitted from the nucleus.

Answer:  A

Objective:  5.1

Global Outcomes:  GO2

 

6) Which of the following types of radiation has the highest energy?

  1. A) -particles
  2. B) -particles
  3. C) -rays
  4. D) visible light
  5. E) All of these have the same energy.

Answer:  C

Objective:  5.1

Global Outcomes:  GO2

 

7) The damaging effects of radiation on the body are a result of

  1. A) the formation of unstable ions or radicals.
  2. B) the formation of radioactive atoms in the body.
  3. C) transmutation reactions in the body.
  4. D) extensive damage to nerve cells.
  5. E) the production of radioactive sodium ions in the body.

Answer:  A

Objective:  5.1

Global Outcomes:  GO2

 

 

8) Which of the following is suitable as a minimum shielding for beta particles?

  1. A) air
  2. B) 1 m of water
  3. C) gloves
  4. D) 1 m of concrete
  5. E) 1 cm of lead

Answer:  C

Objective:  5.1

Global Outcomes:  GO2

9) For Sr, there are

  1. A) 85 protons and 38 neutrons.
  2. B) 47 protons and 38 neutrons.
  3. C) 38 protons and 47 neutrons.
  4. D) 38 protons and 85 neutrons.
  5. E) 85 protons and 47 neutrons.

Answer:  C

Objective:  5.1

Global Outcomes:  GO4

 

10) Which is NOT a way to minimize your exposure to radiation?

  1. A) wearing a lead apron
  2. B) keeping a good distance
  3. C) standing behind a thick concrete wall
  4. D) wearing lead-lined gloves
  5. E) staying a longer time

Answer:  E

Objective:  5.1

Global Outcomes:  GO2

 

11) The process in which a nucleus spontaneously breaks down by emitting radiation is known as

  1. A) transmutation.
  2. B) transformation.
  3. C) fusion.
  4. D) a chain reaction.
  5. E) radioactive decay.

Answer:  E

Objective:  5.1

Global Outcomes:  GO2

 

 

12) Gamma rays require the heaviest shielding of all the common types of nuclear radiation because gamma rays have the

  1. A) highest energy.
  2. B) most intense color.
  3. C) lowest energy.
  4. D) largest particles.
  5. E) heaviest particles.

Answer:  A

Objective:  5.1

Global Outcomes:  GO2

 

13) If absorbed internally, alpha particle emitters are the most damaging because alpha particles

  1. A) have the largest charge.
  2. B) have the greatest energy.
  3. C) have the greatest mass.
  4. D) consist of high energy electrons.
  5. E) consist of pure energy.

Answer:  C

Objective:  5.1

Global Outcomes:  GO2

14) A nuclear equation is balanced when

  1. A) the same elements are found on both sides of the equation.
  2. B) the sum of the mass numbers and the sum of the atomic numbers of the particles and atoms are the same on both sides of the equation.
  3. C) the same particles and atoms are on both sides of the equation.
  4. D) different particles and atoms are on both sides of the equation.
  5. E) the charges of the particles and atoms are the same on both sides of the equation.

Answer:  B

Objective:  5.2

Global Outcomes:  GO2

 

15) The nuclear reaction shown below is an example of what type of process?

 

Th Rn + He

 

  1. A) fusion
  2. B) fission
  3. C) translation
  4. D) alpha decay
  5. E) betadecay

Answer:  D

Objective:  5.2

Global Outcomes:  GO4

 

 

16) When a positron is emitted from the nucleus of an atom, the nuclear mass

  1. A) increases by two units.
  2. B) decreases by one unit.
  3. C) increases by one unit.
  4. D) decreases by two units.
  5. E) remains the same.

Answer:  E

Objective:  5.2

Global Outcomes:  GO4

 

17) When an alpha particle is emitted from the nucleus of an atom, the nuclear mass

  1. A) increases by two units.
  2. B) decreases by four units.
  3. C) increases by one unit.
  4. D) decreases by two units.
  5. E) remains the same.

Answer:  B

Objective:  5.2

Global Outcomes:  GO4

18) When a gamma ray is emitted from the nucleus of an atom, the nuclear mass

  1. A) increases by two units.
  2. B) decreases by one unit.
  3. C) increases by one unit.
  4. D) decreases by two units.
  5. E) remains the same.

Answer:  E

Objective:  5.2

Global Outcomes:  GO4

 

19) In the nuclear equation of a beta emitter

  1. A) the new nucleus contains 2 fewer protons.
  2. B) the new nucleus contains 2 more protons.
  3. C) the mass number of the new nucleus is 4 less than that of the original nucleus.
  4. D) the new nucleus contains 1 more proton.
  5. E) the new nucleus contains 1 less proton.

Answer:  D

Objective:  5.2

Global Outcomes:  GO4

 

 

20) The product from the alpha decay of U is

  1. A)
  2. B)
  3. C)
  4. D)
  5. E)

Answer:  C

Objective:  5.2

Global Outcomes:  GO4

21) Nitrogen-17 is a beta emitter. What is the isotope produced in the radioactive decay?

  1. A) C
  2. B) B
  3. C) N
  4. D) F
  5. E) O

Answer:  E

Objective:  5.2

Global Outcomes:  GO4

 

22) The nuclear reaction

 

Sn Sb + ?

 

is an example of

  1. A) fusion.
  2. B) fission.
  3. C) translation.
  4. D) alpha decay.
  5. E) beta decay.

Answer:  E

Objective:  5.2

Global Outcomes:  GO2

 

 

23) What is the radioactive particle released in the following nuclear equation?

 

Sr Y + ?

 

  1. A) alpha particle
  2. B) beta particle
  3. C) gamma ray
  4. D) proton
  5. E) neutron

Answer:  B

Objective:  5.2

Global Outcomes:  GO4

24) What is the radioactive particle released in the following nuclear equation?

 

W Hf + ?

 

  1. A) alpha particle
  2. B) beta particle
  3. C) gamma ray
  4. D) proton
  5. E) neutron

Answer:  A

Objective:  5.2

Global Outcomes:  GO2

 

25) What is missing in the nuclear reaction shown below?

 

B + He N + ________

 

  1. A) gamma radiation
  2. B) a positron
  3. C) a neutron
  4. D) an alpha particle
  5. E) a beta particle

Answer:  C

Objective:  5.2

Global Outcomes:  GO2

 

 

26) What is missing in the nuclear reaction shown below?

 

B + He ________ + n

 

  1. A) a neutron
  2. B) B
  3. C) N
  4. D) N
  5. E) N

Answer:  D

Objective:  5.2

Global Outcomes:  GO2

27) What is missing in the nuclear reaction shown below?

 

Zn + p ________

 

  1. A) a proton
  2. B) Ga
  3. C) Ga
  4. D) Zn
  5. E) Cu

Answer:  B

Objective:  5.2

Global Outcomes:  GO2

 

 

28) What is the radiation particle used in the bombardment of nitrogen-14?

 

N + ? C + H

 

  1. A) alpha particle
  2. B) beta particle
  3. C) gamma ray
  4. D) proton
  5. E) neutron

Answer:  E

Objective:  5.2

Global Outcomes:  GO7

 

29) When aluminum-27 is bombarded with a neutron, a gamma ray is emitted. What radioactive isotope is produced?

  1. A) silicon-27
  2. B) silicon-28
  3. C) aluminum-28
  4. D) magnesium-27
  5. E) magnesium-28

Answer:  C

Objective:  5.2

Global Outcomes:  GO4

30) Radium-226 decays by alpha decay to

  1. A) barium-131.
  2. B) cobalt-60.
  3. C) carbon-14.
  4. D) polonium-218.
  5. E) radon-222.

Answer:  E

Objective:  5.2

Global Outcomes:  GO4

 

31) Iodine-131 decays by beta decay to

  1. A) iodine-132.
  2. B) tellurium-131.
  3. C) iodine-130.
  4. D) bromine-131.
  5. E) xenon-131.

Answer:  E

Objective:  5.2

Global Outcomes:  GO4

 

 

32) A sample of cerium-141 for a diagnostic test was dissolved in saline solution to an activity of 4.5 mCi/mL. If the patient undergoing the test needs a dose of 10. mCi, how much of the solution should be injected into the patient?

  1. A) 45 mL
  2. B) .45 mL
  3. C) 2.2 mL
  4. D) 22 mL
  5. E) 4.5 mL

Answer:  C

Objective:  5.3

Global Outcomes:  GO9

 

33) The unit used to measure the amount of radiation absorbed by a gram of material is called then

  1. A) rad.
  2. B) RBE.
  3. C) curie.
  4. D) rem.
  5. E) MPD.

Answer:  A

Objective:  5.3

Global Outcomes:  GO2

 

34) A patient receives 4.2 103 mrads of iodine-131, which emits -particles. If the factor that adjusts for biological damage is 1 for -particles, how many rems did the patient receive?

  1. A) 4
  2. B) 0.4
  3. C) 0.3
  4. D) 2
  5. E) 40

Answer:  A

Objective:  5.3

Global Outcomes:  GO4

35) A patient receives 10 mrads of gamma radiation. If the factor that adjusts for biological damage for for gamma radiation is 1, how many mrems did the patient receive?

  1. A) 2 mrem
  2. B) 5 mrem
  3. C) 10 mrem
  4. D) 20 mrem
  5. E) 200 mrem

Answer:  C

Objective:  5.3

Global Outcomes:  GO4

 

 

36) Gamma rays may be detected using

  1. A) a Geiger counter.
  2. B) a film badge.
  3. C) X-ray film.
  4. D) all of the above devices.
  5. E) none of the above devices.

Answer:  D

Objective:  5.3

Global Outcomes:  GO2

 

37) A sample of technetium-99m has an activity of 1.5 Ci. How many disintegrations occur in the technetium-99m sample in 5.0 sec?

  1. A) 5.6 1010
  2. B) 2.8 1011
  3. C) 1.1 1010
  4. D) 7.5
  5. E) 2.0 10-10

Answer:  B

Objective:  5.3

Global Outcomes:  GO4

 

38) A person begins to suffer radiation sickness at an exposure level of

  1. A) 25 rem.
  2. B) 5 rem.
  3. C) 500 rem.
  4. D) 100 rem.
  5. E) 600 rem.

Answer:  D

Objective:  5.3

Global Outcomes:  GO7

39) The recommended dosage of I-131 for a test is 4.2 microcuries per kg of body weight. How many mCi should be given to a 55 kg patient? (1 mCi = 1000 Ci)

  1. A) 230 mCi
  2. B) 0.23 mCi
  3. C) 0.076 mCi
  4. D) 760 mCi
  5. E) 13.8 mCi

Answer:  B

Objective:  5.3

Global Outcomes:  GO7

 

 

40) One symptom of mild radiation sickness is

  1. A) a lowered white cell count.
  2. B) a raised white cell count.
  3. C) a lowered red blood cell count.
  4. D) a raised red blood cell count.
  5. E) a white cell count of zero.

Answer:  A

Objective:  5.3

Global Outcomes:  GO7

 

41) Why is it important that radioisotopes used in diagnostic tests have short half-lives?

  1. A) These radioisotopes have a greater activity so they are easier to monitor.
  2. B) This minimizes the harmful side effects of the radiation.
  3. C) This is necessary so the radioisotopes will have high energy.
  4. D) These radioisotopes are less expensive.
  5. E) These radioisotopes are more abundant in nature.

Answer:  B

Objective:  5.4

Global Outcomes:  GO2

 

42) Sodium-24 has a half-life of 15 hours. How many hours is three half-lives?

  1. A) 60 hours
  2. B) 45 hours
  3. C) 30 hours
  4. D) 15 hours
  5. E) 7.5 hours

Answer:  B

Objective:  5.4

Global Outcomes:  GO4

43) The half-life of a radioisotope is

  1. A) one-half of the time it takes for the radioisotope to completely decay to a nonradioactive isotope.
  2. B) the time it takes for the radioisotope to become an isotope with one-half of the atomic weight of the original radioisotope.
  3. C) the time it takes for the radioisotope to become an isotope with one-half the atomic number of the original radioisotope.
  4. D) the time it takes for the radioisotope to lose one-half of its neutrons.
  5. E) the time it takes for one-half of the sample to decay.

Answer:  E

Objective:  5.4

Global Outcomes:  GO7

 

 

44) Iodine-123, which is used for diagnostic imaging in the thyroid, has a half-life of 13 hours. If 50.0 mg of I-123 were prepared at 8:00 a.m. on Monday, how many mg remain at 10:00 a.m. on the following day?

  1. A) 50.0 mg
  2. B) 25.0 mg
  3. C) 12.5 mg
  4. D) 6.25 mg
  5. E) 3.13 mg

Answer:  C

Objective:  5.4

Global Outcomes:  GO4

 

45) A wooden object from a prehistoric site has a carbon-14 activity of 10 counts per minute (cpm) compared to 40 cpm for new wood. If carbon-14 has a half-life of 5730 years, what is the age of the wood?

  1. A) 1430 yr
  2. B) 5730 yr
  3. C) 11,500 yr
  4. D) 17,200 yr
  5. E) 22,900 yr

Answer:  C

Objective:  5.4

Global Outcomes:  GO4

 

46) Krypton-79 has a half-life of 35 hours. How many half-lives have passed after 105 hours?

  1. A) 1 half-life
  2. B) 2 half-lives
  3. C) 3 half-lives
  4. D) 4 half-lives
  5. E) 5 half-lives

Answer:  C

Objective:  5.4

Global Outcomes:  GO4

47) The half-life of bromine-74 is 25 min. How much of a 4.0 mg sample is still active after 75 min?

  1. A) 0.50 mg
  2. B) 1.0 mg
  3. C) 2.0 mg
  4. D) 0.25 mg
  5. E) 4.0 mg

Answer:  A

Objective:  5.4

Global Outcomes:  GO4

 

 

48) An imaging technique in which a computer monitors the degree of absorption of X-ray beams is known as

  1. A) positron emission tomography (PET).
  2. B) magnetic resonance imaging (MRI).
  3. C) computerized tomography (CT).
  4. D) radioactive iodine uptake (RAIU).
  5. E) a scan.

Answer:  C

Objective:  5.5

Global Outcomes:  GO7

 

49) An imaging technique that detects the energy emitted by hydrogen atoms in a magnetic field is known as

  1. A) positron emission tomography (PET).
  2. B) computerized tomography (CT).
  3. C) magnetic resonance imaging (MRI).
  4. D) radioactive tracer study.
  5. E) supermagnetic tomography (SMT).

Answer:  C

Objective:  5.5

Global Outcomes:  GO7

 

50) The most widely used medical isotope in nuclear medicine is

  1. A) Tc-99m.
  2. B) I-131.
  3. C) P-32.
  4. D) I-125.
  5. E) Co-60.

Answer:  A

Objective:  5.5

Global Outcomes:  GO7

 

51) The dosage of technetium-99m for myocardial imaging is 280 Ci/kg of body weight. How many mCi should be given to a patient weighing 65 kg? (1 mCi = 1000 Ci)

  1. A) 0.0043 mCi
  2. B) 4.3 mCi
  3. C) 18 mCi
  4. D) 230 mCi
  5. E) 1.8 104mCi

Answer:  C

Objective:  5.5

Global Outcomes:  GO4

 

52) A patient receives 3.0 mL of a solution containing technetium-99m for a breast image. If the activity of the technetium-99m is 9.5 mCi/mL, what is the dose received by the patient?

  1. A) 3.2 mCi
  2. B) 29 mCi
  3. C) 320 Ci
  4. D) 9.5 mCi
  5. E) 28.5 mCi

Answer:  B

Objective:  5.5

Global Outcomes:  GO4

 

53) When an atom of uranium-235 is bombarded with neutrons, it splits into smaller nuclei and produces a great amount of energy. This nuclear process is called

  1. A) fission.
  2. B) fusion.
  3. C) decomposition.
  4. D) chain reaction.
  5. E) ionization.

Answer:  A

Objective:  5.6

Global Outcomes:  GO7

 

54) In the Sun, nuclei of hydrogen combine to form a larger nucleus and release a great amount of energy. The process is known as

  1. A) fission.
  2. B) fusion.
  3. C) metathesis.
  4. D) chain reaction.
  5. E) ionization.

Answer:  B

Objective:  5.6

Global Outcomes:  GO7

 

 

5.2   Short Answer Questions

 

1) One symbol for the particle is . Another symbol for the same particle is ________.

Answer:  e

Objective:  5.1

Global Outcomes:  GO2

 

2) Tc Tc + ________

Answer: 

Objective:  5.2

Global Outcomes:  GO2

3) U + n ________ + Kr + 3n + energy

Answer:  Ba

Objective:  5.2

Global Outcomes:  GO2

 

4) Sr ________ + e + energy

Answer:  Y

Objective:  5.2

Global Outcomes:  GO2

 

5) The radiation dose required to produce death in one-half of the exposed subject animals is termed the ________.

Answer:  LD50

Objective:  5.3

Global Outcomes:  GO2

 

6) A sample of phosphorus-32 with an activity of 2.0 mCi produces ________ disintegrations per second.

(1 Ci = 3.7 1010 disintegrations/sec).

Answer:  7.4 107

Objective:  5.3

Global Outcomes:  GO4

 

7) The common unit of radioactivity which is used to measure the biological damage is the ________.

Answer:  rem

Objective:  5.3

Global Outcomes:  GO7

 

 

8) The time needed for a radioactive sample to decay to one-half of its original activity is called the ________.

Answer:  half-life

Objective:  5.4

Global Outcomes:  GO7

 

9) The radioisotope used as a diagnostic tool to measure thyroid function is ________.

Answer:  I-131

Objective:  5.5

Global Outcomes:  GO7

 

10) The diagnostic imaging technique that depends on magnetic fields and radio waves, not radioactivity, is called ________.

Answer:  MRI or magnetic resonance imaging

Objective:  5.5

Global Outcomes:  GO7

11) The process by which a large nucleus breaks into smaller pieces, releasing large amounts of energy is called nuclear ________.

Answer:  fission

Objective:  5.6

Global Outcomes:  GO7

 

5.3   True/False Questions

 

1) The production of nitrogen-13 and a neutron from boron-10 by bombardment with a helium-4 nucleus is an example of radioactive decay.

Answer:  FALSE

Objective:  5.1

Global Outcomes:  GO2

 

2) The correct symbol for hydrogen-3 is He.

Answer:  FALSE

Objective:  5.1

Global Outcomes:  GO2

 

3) An alpha particle is emitted when Am-241 decays to Np-237.

Answer:  TRUE

Objective:  5.1

Global Outcomes:  GO2

 

4) A beta particle is emitted when Co-60 decays to Fe-60.

Answer:  FALSE

Objective:  5.1

Global Outcomes:  GO2

 

 

5) Exposure to radiation is unavoidable because some radioactive elements occur naturally.

Answer:  TRUE

Objective:  5.3

Global Outcomes:  GO2

 

6) One symptom of radiation sickness is an increased production of red blood cells.

Answer:  FALSE

Objective:  5.3

Global Outcomes:  GO2

 

7) Irradiation of food for sterilization is usually carried out using gamma irradiation.

Answer:  TRUE

Objective:  5.3

Global Outcomes:  GO2

 

8) Irradiated food contains small amounts of added radioactive isotopes.

Answer:  FALSE

Objective:  5.3

Global Outcomes:  GO2

9) One mCi of a radioactive substance emits more radiation than one Ci of the same substance.

Answer:  TRUE

Objective:  5.2

Global Outcomes:  GO2

 

10) Medical radioisotopes used for diagnostic purposes typically have short half-lives.

Answer:  TRUE

Objective:  5.2

Global Outcomes:  GO2

 

11) If the half-life of hydrogen-3 is 11.8 years, after two half-lives the radioactivity of a sample will be reduced to one-half of the original amount.

Answer:  FALSE

Objective:  5.4

Global Outcomes:  GO2

 

12) One type of radiation that is not usually used for medical procedures is the cosmic ray.

Answer:  TRUE

Objective:  5.5

Global Outcomes:  GO2

 

13) Nuclear fission as used in nuclear power plants produces radioactive waste with long half-lives.

Answer:  TRUE

Objective:  5.6

Global Outcomes:  GO2

 

14) Nuclear fusion does not occur naturally.

Answer:  FALSE

Objective:  5.6

Global Outcomes:  GO2

5.4   Matching Questions

 

Indicate whether each of the following is characteristic of the fission or fusion process.

 

  1. A) both fission and fusion
  2. B) fusion
  3. C) fission

 

1) A large nucleus is split into smaller nuclei.

Objective:  5.6

Global Outcomes:  GO2

 

2) Very high temperatures must be achieved to initiate the reaction.

Objective:  5.6

Global Outcomes:  GO2

 

3) This nuclear process provides the energy of the Sun.

Objective:  5.6

Global Outcomes:  GO2

 

4) This process produces radioactive by-products.

Objective:  5.6

Global Outcomes:  GO2

 

5) Large amounts of energy are released.

Objective:  5.6

Global Outcomes:  GO2

 

6) Two small nuclei combine to form a larger nucleus.

Objective:  5.6

Global Outcomes:  GO2

 

Answers: 1) C 2) B 3) B 4) C 5) A 6) B

 


Choose the type of radiation from Column 2 that best matches each item in Column 1.

 

  1. A) beta particle
  2. B) positron
  3. C) alpha particle
  4. D) proton
  5. E) neutron
  6. F) gamma ray

 

7)         

Objective:  5.1

Global Outcomes:  GO7

 

8)         

Objective:  5.1

Global Outcomes:  GO7

 

9)         

Objective:  5.1

Global Outcomes:  GO6

 

10) H

Objective:  5.1

Global Outcomes:  GO7

 

11) n

Objective:  5.1

Global Outcomes:  GO7

 

12) e

Objective:  5.1

Global Outcomes:  GO7

 

13) e

Objective:  5.1

Global Outcomes:  GO7

 

Answers: 7) C 8) A 9) F 10) D 11) E 12) B 13) A

 

General, Organic & Biological Chemistry, 5e (Timberlake)

Chapter 11   Acids and Bases

 

11.1   Multiple-Choice Questions

 

1) According to the Arrhenius concept, if NaOH were dissolved in water, it would act as

  1. A) a base.
  2. B) an acid.
  3. C) a source of hydronium ions.
  4. D) a source of H-
  5. E) a proton donor.

Answer:  A

Objective:  11.1

Global Outcomes:  GO2

 

2) According to the Arrhenius concept, if HNO3 were dissolved in water, it would act as

  1. A) a base.
  2. B) an acid.
  3. C) a source of hydroxide ions.
  4. D) a source of H-
  5. E) a proton acceptor.

Answer:  B

Objective:  11.1

Global Outcomes:  GO2

 

3) The name given to an aqueous solution of HBr is

  1. A) hydrogen bromide.
  2. B) hydrobromic acid.
  3. C) bromic acid.
  4. D) bromous acid.
  5. E) hypobromous acid.

Answer:  B

Objective:  11.1

Global Outcomes:  GO2

 

4) The name given to an aqueous solution of HNO3 is

  1. A) nitric acid.
  2. B) nitrous acid.
  3. C) hydrogen nitrate.
  4. D) hydronitrogen acid.
  5. E) hyponitric acid.

Answer:  A

Objective:  11.1

Global Outcomes:  GO2

 

5) The name given to an aqueous solution of HClO3 is

  1. A) chlorous acid.
  2. B) hypochlorous acid.
  3. C) chloric acid.
  4. D) hydrochloric acid.
  5. E) hypochloric acid.

Answer:  C

Objective:  11.1

Global Outcomes:  GO2

 

6) Which one of the following is characteristic of a base?

  1. A) produces H3O+ in water
  2. B) has a sour taste
  3. C) has a slippery, soapy feel
  4. D) turns blue litmus red
  5. E) is insoluble in water

Answer:  C

Objective:  11.1

Global Outcomes:  GO2

 

7) The correct formula for sulfuric acid is

  1. A) H2SO4.
  2. B) H2SO3.
  3. C) H2SO4-.
  4. D) H2SO3-.
  5. E) SO42-.

Answer:  A

Objective:  11.1

Global Outcomes:  GO2

 

8) The name of Al(OH)3 is

  1. A) aluminum trihydroxide.
  2. B) monoaluminum trihydroxide.
  3. C) aluminum hydroxide.
  4. D) aluminum(III) hydroxide.
  5. E) aluminum oxygen hydride.

Answer:  C

Objective:  11.1

Global Outcomes:  GO2

 

 

9) According to the Brnsted-Lowry definition,

  1. A) an acid is a proton acceptor.
  2. B) a base produces H+ions in aqueous solutions.
  3. C) a base is a proton donor.
  4. D) a base is a proton acceptor.
  5. E) an acid acts as the solvent.

Answer:  D

Objective:  11.2

Global Outcomes:  GO2

10) Identify the Brnsted-Lowry acids in the following reaction.

 

H2O + CO32-  HCO3- + OH-

 

  1. A) H2O/HCO3-
  2. B) CO32-/HCO3-
  3. C) OH-/HCO3-
  4. D) CO32-/OH-
  5. E) H2CO3/H2O

Answer:  A

Objective:  11.2

Global Outcomes:  GO2

 

11) The conjugate base of HClO3 is

  1. A) HClO2.
  2. B) ClO3-.
  3. C) Cl(OH)2.
  4. D) ClO3.
  5. E) HClO.

Answer:  B

Objective:  11.2

Global Outcomes:  GO2

 

12) The conjugate acid of HSO4- is

  1. A) SO42-.
  2. B) HSO4.
  3. C) H2SO4.
  4. D) H2SO4-.
  5. E) HSO3-.

Answer:  C

Objective:  11.2

Global Outcomes:  GO2

 

 

13) Which of the following is the strongest acid?

  1. A) H3PO4
  2. B) NH4+
  3. C) NaOH
  4. D) H2CO3
  5. E) HCl

Answer:  E

Objective:  11.3

Global Outcomes:  GO2

14) The stronger the acid, the ________ the conjugate base.

  1. A) stronger
  2. B) weaker

Answer:  B

Objective:  11.3

Global Outcomes:  GO2

 

15) Which of the following is the strongest base?

  1. A) H3PO4
  2. B) NH3
  3. C) NaOH
  4. D) NaCl
  5. E) HCl

Answer:  C

Objective:  11.3

Global Outcomes:  GO2

 

16) Which of the following is correctly identified?

  1. A) NH3, strong acid
  2. B) NaOH, strong base
  3. C) HCl, weak acid
  4. D) H2CO3, strong acid
  5. E) Ca(OH)2, weak base

Answer:  B

Objective:  11.3

Global Outcomes:  GO2

 

17) Ammonium hydroxide is a weak base because

  1. A) it is a dilute solution.
  2. B) it is only slightly soluble in water.
  3. C) it cannot hold on to its hydroxide ions.
  4. D) it dissociates only slightly in water.
  5. E) it is completely ionized in aqueous solution.

Answer:  D

Objective:  11.3

Global Outcomes:  GO2

 

 

18) Which of the following is the strongest acid?

  1. A) HF (Kafor HF is 7.2 10-4)
  2. B) HCN (Kafor HCN is 4.9 10-10)
  3. C) HCNO (Kafor HCNO is 2 10-4)
  4. D) H3BO3(Kafor H3BO3 is 5.4 10-10)

Answer:  A

Objective:  11.4

Global Outcomes:  GO4

19) Which of the following is the weakest acid?

  1. A) HF (Kafor HF is 7.2 10-4)
  2. B) HCN (Kafor HCN is 4.9 10-10)
  3. C) HCNO (Kafor HCNO is 2 10-4)
  4. D) H3BO3(Kafor H3BO3 is 5.4 10-10)

Answer:  B

Objective:  11.4

Global Outcomes:  GO4

 

20) The Ka for hydrofluoric acid is 7.2 10-4. This means that HF is

  1. A) neutral in water solution.
  2. B) able to react with HCl.
  3. C) a weak acid.
  4. D) a strong acid.
  5. E) ionic.

Answer:  C

Objective:  11.4

Global Outcomes:  GO4

 

21) Predict whether the equilibrium of the following reaction favors reactants or products:

 

NH4+ + H2O NH3 + H3O+

 

  1. A) Reactants are favored.
  2. B) Products are favored.
  3. C) Neither side is favored.

Answer:  A

Objective:  11.4

Global Outcomes:  GO2

 

 

22) For Kw, the product of [ H3O+] and [OH-] is

  1. A) 1.0 10-14.
  2. B) 1.0 10-7.
  3. C) 1.0 10-1.
  4. D) 1.0.
  5. E) 1.0 1014.

Answer:  A

Objective:  11.5

Global Outcomes:  GO2

23) Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution?

  1. A) In acids, [OH-] is greater than [ H3O+].
  2. B) In bases, [OH-] = [ H3O+].
  3. C) In neutral solutions, [ H3O+] = [ H2O].
  4. D) In bases, [OH-] is greater than [ H3O+].
  5. E) In bases, [OH-] is less than [ H3O+].

Answer:  D

Objective:  11.5

Global Outcomes:  GO2

 

24) What is the [ H3O+] in a solution with [OH-] = 1 10-12 M?

  1. A) 1 10-12 M
  2. B) 1 102 M
  3. C) 1 10-7 M
  4. D) 1 10-8 M
  5. E) 1 10-2 M

Answer:  E

Objective:  11.5

Global Outcomes:  GO4

 

25) What is the [OH-] in a solution that has a [ H3O+] = 1 10-6 M?

  1. A) 1 10-2 M
  2. B) 1 10-6 M
  3. C) 1 10-8 M
  4. D) 1 10-10 M
  5. E) 1 10-12 M

Answer:  C

Objective:  11.5

Global Outcomes:  GO4

 

 

26) What is the [OH-] in a solution that has a [ H3O+] = 2.0 10-4 M?

  1. A) 2.0 10-10 M
  2. B) 5.0 10-10 M
  3. C) 1.0 10-10 M
  4. D) 2.0 10-4 M
  5. E) 5.0 10-11 M

Answer:  E

Objective:  11.5

Global Outcomes:  GO4

27) What is the [ H3O+] in a solution that has a [OH-] = 5.0 10-2 M?

  1. A) 2.0 10-12 M
  2. B) 2.0 10-2 M
  3. C) 1.0 10-14 M
  4. D) 2.0 10-4 M
  5. E) 5.0 10-12 M

Answer:  A

Objective:  11.5

Global Outcomes:  GO4

 

28) A solution which has [ H3O+] = 6.7 10-8 M is

  1. A) acidic.
  2. B) basic.
  3. C) neutral.

Answer:  B

Objective:  11.5

Global Outcomes:  GO4

 

29) A solution which has [OH-] = 4.6 10-6 M is

  1. A) acidic.
  2. B) basic.
  3. C) neutral.

Answer:  B

Objective:  11.5

Global Outcomes:  GO4

 

30) A solution which has [OH-] = 3.4 10-12 M is

  1. A) acidic.
  2. B) basic.
  3. C) neutral..

Answer:  A

Objective:  11.5

Global Outcomes:  GO4

 

 

31) A solution with a pH of 4 is

  1. A) extremely acidic.
  2. B) moderately acidic.
  3. C) neutral.
  4. D) slightly basic.
  5. E) extremely basic.

Answer:  B

Objective:  11.6

Global Outcomes:  GO4

32) What is the pH of a solution with [ H3O+] = 1 10-9 M?

  1. A) 1.0 10-5 M
  2. B) -9.0
  3. C) 5.0
  4. D) -5.0
  5. E) 9.0

Answer:  E

Objective:  11.6

Global Outcomes:  GO4

 

33) What is the pH of a solution with [ H3O+] = 3.0 10-3 M?

  1. A) 3.0 10-3
  2. B) 2.52
  3. C) 3.0
  4. D) -2.52
  5. E) 9.0

Answer:  B

Objective:  11.6

Global Outcomes:  GO4

 

34) What is the pH of a solution with [OH-] = 1 10-4 M?

  1. A) 10.0
  2. B) -10.0
  3. C) 4.0
  4. D) -4.0
  5. E) 1.0 10-10

Answer:  A

Objective:  11.6

Global Outcomes:  GO4

 

 

35) What is the pH of a solution with [OH-] = 2.0 10-10 M?

  1. A) 9.70
  2. B) -9.70
  3. C) 4.30
  4. D) -4.30
  5. E) 2.0 10-10

Answer:  C

Objective:  11.6

Global Outcomes:  GO4

 

36) The [ H3O+] of a solution with pH = 2 is

  1. A) 10 M.
  2. B) -10 M.
  3. C) 1 102
  4. D) 1 10-2
  5. E) 1 10-12

Answer:  D

Objective:  11.6

Global Outcomes:  GO4

37) In which of the following are the pH values arranged from the most basic to the most acidic?

  1. A) 1, 3, 6, 8, 11, 14
  2. B) 2, 5, 7, 9, 10, 11
  3. C) 14, 10, 7, 4, 3, 1
  4. D) 14, 10, 7, 1, 3, 5
  5. E) 7, 10, 14, 4, 3, 1

Answer:  C

Objective:  11.6

Global Outcomes:  GO4

 

38) In which of the following are the pH values arranged from the most acidic to the most basic?

  1. A) 1, 3, 6, 8, 11, 14
  2. B) 2, 5, 7, 9, 10, 1.1
  3. C) 14, 10, 7, 4, 3, 1
  4. D) 14, 10, 7, 1, 3, 5
  5. E) 7, 10, 14, 4, 3, 1

Answer:  A

Objective:  11.6

Global Outcomes:  GO4

 

 

39) In a sulfuric acid solution, where the  [ H3O+] is 0.01 M, what is the pH?

  1. A) pH = 12.0
  2. B) pH = 2.0
  3. C) pH = 3.0
  4. D) pH = 11.0
  5. E) pH = 5.0

Answer:  B

Objective:  11.6

Global Outcomes:  GO4

 

40) The [ H3O+] of a solution with pH = 5.60 is

  1. A) 3 10-6
  2. B) 2.5 10-8
  3. C) 2.5 10-6
  4. D) 4.0 10-6
  5. E) 4.0 10-9

Answer:  C

Objective:  11.6

Global Outcomes:  GO4

 

41) The  [OH-] of a solution with pH = 8.34 is

  1. A) 5 10-9
  2. B) 4.6 10-9
  3. C) 2.2 10-9
  4. D) 3 10-6
  5. E) 2.2 10-6

Answer:  C

Objective:  11.6

Global Outcomes:  GO4

42) When a piece of magnesium metal is added to hydrochloric acid, what gas is produced?

  1. A) oxygen
  2. B) chlorine
  3. C) nitrogen
  4. D) carbon dioxide
  5. E) hydrogen

Answer:  E

Objective:  11.7

Global Outcomes:  GO2

 

 

43) An acid and base react to form a salt and water in a(n) ________ reaction.

  1. A) ionization
  2. B) dissociation
  3. C) oxidation
  4. D) neutralization
  5. E) reduction

Answer:  D

Objective:  11.7

Global Outcomes:  GO2

 

44) In a neutralization reaction

  1. A) two acids react to form water.
  2. B) water and a salt react to form an acid and a base.
  3. C) an acid and a salt react to form water and a base.
  4. D) a base and a salt react to form water and an acid.
  5. E) an acid and a base react to form a salt and water.

Answer:  E

Objective:  11.7

Global Outcomes:  GO2

 

45) Which of the following is the correctly balanced equation for the complete neutralization of H3PO4 with Ca(OH)2?

  1. A) H3PO4+ Ca(OH)2 CaHPO4 + 2H2O
  2. B) 3H3PO4+ Ca(OH)2 Ca3(PO4)2 + 5H2O
  3. C) H3PO4+ Ca(OH)2 Ca3(PO4)2+ H2O
  4. D) 2H3PO4+ 3Ca(OH)2 Ca3(PO4)2 + 6H2O
  5. E) 4H3PO4+ 6Ca(OH)2 2Ca3(PO4)2 + 12H2O

Answer:  D

Objective:  11.7

Global Outcomes:  GO2

 

46) The neutralization reaction between Al(OH)3 and HNO3 produces the salt with the formula

  1. A) H2
  2. B) AlNO3.
  3. C) AlH2.
  4. D) Al(NO3)3.
  5. E) NO3

Answer:  D

Objective:  11.7

Global Outcomes:  GO2

 

47) How many moles of H2O are produced when 1 mole of Mg(OH)2 reacts with 1 mole of H2SO4?

  1. A) 1
  2. B) 2
  3. C) 3
  4. D) 4
  5. E) 5

Answer:  B

Objective:  11.7

Global Outcomes:  GO4

 

48) In a neutralization reaction, how many moles of HClO4 react with 1 mole of  Al(OH)3?

  1. A) 1
  2. B) 2
  3. C) 3
  4. D) 4
  5. E) 5

Answer:  C

Objective:  11.7

Global Outcomes:  GO4

 

49) Which of the following is a neutralization reaction?

  1. A) KCl + NaNO3 KNO3+ NaCl
  2. B) HNO3+ KOH H2O + KNO3
  3. C) H2O + SO3 H2SO4
  4. D) 4Na + O2 2Na2O
  5. E) 2NO2 2NO + O2

Answer:  B

Objective:  11.7

Global Outcomes:  GO2

 

50) 25.0 mL of 0.212 M NaOH is neutralized by 13.6 mL of an HCl solution. The molarity of the HCl solution is

  1. A) 0.212 M.
  2. B) 0.115 M.
  3. C) 0.500 M.
  4. D) 0.390 M.
  5. E) 0.137 M.

Answer:  D

Objective:  11.8

Global Outcomes:  GO4

 

51) What is the molarity of a KOH solution if 25.0 mL neutralizes 35.0 mL of a 0.200 M HCl solution?

  1. A) 0.267 M
  2. B) 0.143 M
  3. C) 0.200 M
  4. D) 0.280 M
  5. E) 0.100 M

Answer:  D

Objective:  11.8

Global Outcomes:  GO4

 

52) A 25.0 mL sample of H3PO4 requires 50.0 mL of 1.50 M NaOH for complete neutralization. What is the molarity of the acid?

 

H3PO4 + 3NaOH Na3PO4 + 3H2O

 

  1. A) 0.333 M
  2. B) 3.00 M
  3. C) 1.50 M
  4. D) 1.00 M
  5. E) 0.750 M

Answer:  D

Objective:  11.8

Global Outcomes:  GO4

 

53) A 25.0 mL sample of H2SO4 requires 20.0 mL of 2.00 M KOH for complete neutralization. What is the molarity of the acid?

 

H2SO4 + 2KOH K2SO4 + 2H2O

 

  1. A) 2.00 M
  2. B) 2.50 M
  3. C) 0.800 M
  4. D) 1.60 M
  5. E) 1.25 M

Answer:  C

Objective:  11.8

Global Outcomes:  GO4

 

54) A 10.0 mL of 0.121 M H2SO4 is neutralized by 17.1 mL of KOH solution. The molarity of the KOH solution is

  1. A) 0.207 M.
  2. B) 0.4141 M.
  3. C) 0.0708 M.
  4. D) 0.428 M.
  5. E) 0.142 M.

Answer:  E

Objective:  11.8

Global Outcomes:  GO4

55) How many milliliters of 0.400 M NaOH are required to completely neutralize 20.0 mL of 0.200 M HCl?

  1. A) 50.0 mL
  2. B) 40.0 mL
  3. C) 0.100 mL
  4. D) 20.0 mL
  5. E) 10.0 mL

Answer:  E

Objective:  11.8

Global Outcomes:  GO4

 

56) How many milliliters of 0.200 M NaOH are required to completely neutralize 5.00 mL of 0.100 M H3PO4?

  1. A) 7.50 mL
  2. B) 2.50 mL
  3. C) 0.833 mL
  4. D) 5.00 mL
  5. E) 15.0 mL

Answer:  A

Objective:  11.8

Global Outcomes:  GO4

 

57) How many milliliters of 0.100 M Ba(OH)2 are required to neutralize 20.0 mL of 0.250 M HCl?

  1. A) 100. mL
  2. B) 50.0 mL
  3. C) 25.0 mL
  4. D) 0.250 mL
  5. E) 0.50 mL

Answer:  C

Objective:  11.8

Global Outcomes:  GO4

 

For the problem(s) that follow, consider the reaction in which magnesium reacts with an HCl solution .

 

Mg(s) + 2HCl(aq) MgCl2 (aq) + H2(g)

 

58) If 2.00 g of Mg reacts completely with 50.0 mL of HCl solution, what is the molarity of the HCl solution?

  1. A) 1.65 M
  2. B) 80.0 M
  3. C) 8.00 M
  4. D) 0.823 M
  5. E) 3.29 M

Answer:  E

Objective:  11.8

Global Outcomes:  GO4

 

59) The function of a buffer is to

  1. A) change color at the end point of a titration.
  2. B) maintain the pH of a solution.
  3. C) be a strong base.
  4. D) maintain a neutral pH.
  5. E) act as a strong acid.

Answer:  B

Objective:  11.9

Global Outcomes:  GO2

 

60) The normal blood pH is about

  1. A) 6.8.
  2. B) 7.0.
  3. C) 7.2.
  4. D) 7.4.
  5. E) 7.6.

Answer:  D

Objective:  11.9

Global Outcomes:  GO2

 

61) In a buffer system of HF and its salt, NaF,

  1. A) the HF neutralizes added acid.
  2. B) the HF neutralizes added base.
  3. C) the HF is not necessary.
  4. D) the F-neutralizes added H2
  5. E) the F-neutralizes added base.

Answer:  B

Objective:  11.9

Global Outcomes:  GO2

 

62) Which of the following is a buffer system?

  1. A) NaCl and NaNO3
  2. B) HCl and NaOH
  3. C) H2CO3and KHCO3
  4. D) NaCl and NaOH
  5. E) H2O and HCl

Answer:  C

Objective:  11.9

Global Outcomes:  GO2

 

 

63) Which of the following could be a buffer?

  1. A) NaF
  2. B) HF + NaF
  3. C) HF + H2O
  4. D) NaF + H2O
  5. E) NaCl + HF

Answer:  B

Objective:  11.9

Global Outcomes:  GO2

64) What is the name of the medical condition of an asthmatic patient with a blood pH of 7.30?

  1. A) respiratory acidosis
  2. B) respiratory alkalosis
  3. C) metabolic acidosis
  4. D) metabolic alkalosis
  5. E) diabetes mellitus

Answer:  A

Objective:  11.9

Global Outcomes:  GO7

 

65) If a condition of hyperventilation occurs, the blood pH of the patient is expected to

  1. A) saturate.
  2. B) increase.
  3. C) decrease.
  4. D) stay the same.
  5. E) concentrate.

Answer:  B

Objective:  11.9

Global Outcomes:  GO7

 

66) When hyperventilation (rapid breathing) causes a patient to exhale large amounts of CO2, the blood pH rises in a condition called

  1. A) metabolic acidosis.
  2. B) metabolic alkalosis.
  3. C) respiratory acidosis.
  4. D) respiratory alkalosis.
  5. E) pulmonary distress.

Answer:  D

Objective:  11.9

Global Outcomes:  GO7

 

 

67) Which solution has the highest pH?

  1. A) a buffer made with 0.10 M acetic acid and 0.01 M sodium acetate
  2. B) a buffer made with 0.10 M acetic acid and 0.10 M sodium acetate
  3. C) a buffer made with 0.01 M acetic acid and 0.10 M sodium acetate
  4. D) a buffer made with 0.01 M acetic acid and 0.01 M sodium acetate
  5. E) All of the buffers have the same pH since they are all made with acetic acid and sodium acetate.

Answer:  C

Objective:  11.9

Global Outcomes:  GO2

 

68) Which solution has the lowest pH?

  1. A) a buffer made with 0.10 M acetic acid and 0.01 M sodium acetate
  2. B) a buffer made with 0.10 M acetic acid and 0.10 M sodium acetate
  3. C) a buffer made with 0.01 M acetic acid and 0.10 M sodium acetate
  4. D) a buffer made with 0.01 M acetic acid and 0.01 M sodium acetate
  5. E) All of the buffers have the same pH since they are all made with acetic acid and sodium acetate.

Answer:  A

Objective:  11.9

Global Outcomes:  GO2

11.2   Short Answer Questions

 

1) The name of HCl is________.

Answer:  hydrochloric acid

Objective:  11.1

Global Outcomes:  GO2

 

2) The conjugate acid of H2PO42- is ________.

Answer:  H2PO4-

Objective:  11.2

Global Outcomes:  GO2

 

3) Identify the conjugate acid-base pairs in the following reaction:

 

HCl + NH3  NH4+ + Cl-

Answer:  HCl/Cl- and NH4+/NH3

Objective:  11.2

Global Outcomes:  GO2

 

4) Write the proper Ka expression for the ionization of acetic acid, HC2H3O2.

Answer:  Ka = [C2H3O2-][H3O+]/[HC2H3O2]

Objective:  11.4

Global Outcomes:  GO2

 

5) If an acid has a Ka << 1, is it classified as a weak acid or a strong acid?

Answer:  a weak acid

Objective:  11.4

Global Outcomes:  GO2

 

6) The pH of 0.0010 M HCl is ________.

Answer:  3.00

Objective:  11.6

Global Outcomes:  GO4

 

7) The pH of 0.0001 M KOH is ________.

Answer:  10.0

Objective:  11.6

Global Outcomes:  GO4

 

8) In a titration experiment, a student used 24.13 mL of 0.111 M sodium hydroxide to neutralize 20.00 mL of a hydrochloric acid solution. What was the molarity of the acid solution?

Answer:  0.134 M

Objective:  11.8

Global Outcomes:  GO4

9) A student had 2.0 L of a sodium hydroxide solution that had a concentration of 0.4000 M. The student needed to make 500 mL of a 0.1000 M solution. How many mL of the concentrated solution was needed?

Answer:  125 mL

Objective:  11.8

Global Outcomes:  GO4

 

10) A student had 25.0 mL of 0.100 M H2SO4 solution. How many mL of a 0.100 M NaOH solution will the sulfuric acid neutralize?

Answer:  50.0 mL

Objective:  11.8

Global Outcomes:  GO4

 

11) What is the pH of a buffer made with 0.10 M acetic acid and 0.01 M sodium acetate?

Answer:  3.74

Objective:  11.8

Global Outcomes:  GO4

 

11.3   True/False Questions

 

1) HCl is hydrochlorous acid.

Answer:  FALSE

Objective:  11.1

Global Outcomes:  GO2

 

2) The conjugate base of HCl is Cl-.

Answer:  TRUE

Objective:  11.2

Global Outcomes:  GO2

 

3) HCl is a strong acid.

Answer:  TRUE

Objective:  11.2

Global Outcomes:  GO2

 

4) A strong acid is completely dissociated in water.

Answer:  TRUE

Objective:  11.3

Global Outcomes:  GO2

 

5) In any water solution, [H3O+][OH-] = 1.0 10-7.

Answer:  FALSE

Objective:  11.5

Global Outcomes:  GO2

 

6) The pH of 0.001 M HCl is 12.0.

Answer:  FALSE

Objective:  11.6

Global Outcomes:  GO4

7) A solution with a pH of 4.0 is more acidic than a solution with a pH of 6.0.

Answer:  TRUE

Objective:  11.6

Global Outcomes:  GO4

 

8) A solution with a pH of 4.0 is basic.

Answer:  FALSE

Objective:  11.6

Global Outcomes:  GO4

 

9) Magnesium metal is not attacked by sulfuric acid solutions.

Answer:  FALSE

Objective:  11.7

Global Outcomes:  GO2

 

10) For most reactions of acids with bases, the resulting products are a salt and water.

Answer:  TRUE

Objective:  11.7

Global Outcomes:  GO2

 

11) If the carbon dioxide level in the blood is too high, more carbonic acid is produced, and this results in the condition termed acidosis.

Answer:  TRUE

Objective:  11.9

Global Outcomes:  GO7

 

12) Alkalosis is the blood condition in which the blood pH is higher than normal.

Answer:  TRUE

Objective:  11.9

Global Outcomes:  GO7

 

13) A buffer is a solution that tends to maintain a neutral pH.

Answer:  FALSE

Objective:  11.9

Global Outcomes:  GO2

11.4   Matching Questions

 

Identify each of the following compounds as an acid, a base, or neither.

 

  1. A) acid
  2. B) base
  3. C) neither

 

1) HCl

Objective:  11.1

Global Outcomes:  GO2

 

2) NaOH

Objective:  11.1

Global Outcomes:  GO2

 

3) NH3

Objective:  11.1

Global Outcomes:  GO2

 

4) H2SO4

Objective:  11.1

Global Outcomes:  GO2

 

5) CO32-

Objective:  11.1

Global Outcomes:  GO2

 

6) NaCl

Objective:  11.1

Global Outcomes:  GO2

 

7) CN-

Objective:  11.1

Global Outcomes:  GO2

 

8) H2CO3

Objective:  11.1

Global Outcomes:  GO2

 

Answers: 1) A 2) B 3) B 4) A 5) B 6) C 7) B 8) A

 


In the following solutions, is the [OH-] greater than, less than, or equal to the [H3O+]?

 

  1. A) less than
  2. B) greater than
  3. C) equal to

 

9) acid

Objective:  11.5

Global Outcomes:  GO2

 

10) base

Objective:  11.5

Global Outcomes:  GO2

 

11) [H3O+] = 1.0 10-6 M

Objective:  11.5

Global Outcomes:  GO4

 

12) [H3O+] = 1.0 10-10 M

Objective:  11.5

Global Outcomes:  GO4

 

13) [H3O+] = 1.0 10-7 M

Objective:  11.5

Global Outcomes:  GO4

 

14) pH = 2

Objective:  11.5

Global Outcomes:  GO4

 

15) pH = 9

Objective:  11.5

Global Outcomes:  GO4

 

Answers: 9) A 10) B 11) A 12) B 13) C 14) A 15) B

 


Identify the following as acids, bases, or neutral solutions.

 

  1. A) neutral
  2. B) acid
  3. C) base

 

16) has a sour taste

Objective:  2.1

Global Outcomes:  GO2

 

17) has a pH = 4.5

Objective:  2.1

Global Outcomes:  GO2

 

18) turns blue litmus paper red

Objective:  2.1

Global Outcomes:  GO2

 

19) contains more hydronium ions than hydroxide ions

Objective:  2.1

Global Outcomes:  GO2

 

20) H2O

Objective:  2.1

Global Outcomes:  GO2

 

21) [H3O+] = 3.4 10-5 M

Objective:  2.1

Global Outcomes:  GO4

 

22) [OH-] = 2.8 10-2 M

Objective:  2.1

Global Outcomes:  GO4

 

23) Ca(OH)2

Objective:  2.1

Global Outcomes:  GO4

 

24) pH =9.0

Objective:  2.1

Global Outcomes:  GO4

 

25) [H3O+] = 1.0 10-7 M

Objective:  2.1

Global Outcomes:  GO4

 

Answers: 16) B 17) B 18) B 19) B 20) A 21) B 22) C 23) C 24) C 25) A

 

General, Organic & Biological Chemistry, 5e (Timberlake)

Chapter 23   Metabolism and Energy Production

 

23.1   Multiple-Choice Questions

 

1) When combined with electron transport, one turn of the citric acid cycle produces ________ ATP.

  1. A) 24
  2. B) 12
  3. C) 10
  4. D) 14
  5. E) 2

Answer:  C

Objective:  23.1

Global Outcomes:  GO2

 

2) Which coenzyme is the electron acceptor in the following reaction?

 

H      H

|       |

  C     C              C =  C

|       |                       |      |

 

  1. A) FAD
  2. B) NAD+
  3. C) FMN
  4. D) NADH
  5. E) FADH2

Answer:  A

Objective:  23.1

Global Outcomes:  GO2

 

3) Which coenzyme is the electron acceptor in the following reaction?

 

OH                O

|

   C           C

|

H

 

  1. A) FAD
  2. B) NAD+
  3. C) FMN
  4. D) NADH
  5. E) FADH2

Answer:  B

Objective:  23.1

Global Outcomes:  GO2

4) NAD+ participates in reactions that produce

  1. A) a CH2
  2. B) a C=O bond.
  3. C) phosphorylation.
  4. D) ADP from ATP.
  5. E) a C-C bond.

Answer:  B

Objective:  23.1

Global Outcomes:  GO2

 

5) FAD is a coenzyme which usually participates in

  1. A) oxidation of alcohols to aldehydes.
  2. B) formation of carbon-carbon double bonds.
  3. C) decarboxylation reactions.
  4. D) phosphorylation reactions.
  5. E) -oxidation reactions.

Answer:  B

Objective:  23.1

Global Outcomes:  GO2

 

6) In order to enter the citric acid cycle, pyruvate is first converted to

  1. A) ate.
  2. B) acetaldehyde.
  3. C) citrate.
  4. D) acetyl CoA.
  5. E) ethanol.

Answer:  D

Objective:  23.1

Global Outcomes:  GO2

 

7) The citric acid cycle is used in the oxidation of

  1. A) glucose only.
  2. B) glucose and fatty acids only.
  3. C) fatty acids only.
  4. D) glucose, fatty acids, and proteins.
  5. E) proteins only.

Answer:  D

Objective:  23.1

Global Outcomes:  GO2

 

8) What electron acceptor(s) is(are) used in the citric acid cycle?

  1. A) FAD only
  2. B) NAD+ only
  3. C) NADH + FADH2+ HS CoA
  4. D) FMN
  5. E) NAD+ + FAD

Answer:  E

Objective:  23.1

Global Outcomes:  GO2

9) Which of the following compounds in the citric acid cycle undergoes oxidative decarboxylation?

  1. A) citrate
  2. B) isocitrate
  3. C) succinate
  4. D) fumarate
  5. E) succinyl CoA

Answer:  B

Objective:  23.1

Global Outcomes:  GO2

 

10) Which of the following is the net reaction for one turn of the citric acid cycle?

  1. A) Acetyl CoA + 3 NAD++ FAD + GDP + Pi + 2H2O 2CO2 + 3 NADH + 3 H+ + FADH2 + HS CoA + GTP
  2. B) Pyruvate + 3 NAD++ FAD + GDP + Pi + 2H2O 3 CO2 + 3 NADH + 3 H+ + FADH2 + GTP
  3. C) Acetyl CoA + NAD++ FAD + GDP + Pi 2 CO2 + NADH + H+ + FADH2 + HS CoA + GTP
  4. D) Glucose + 2 NAD++ 2GDP + 2 Pi+ 2H2O 2Pyruvate + 2 NADH + 2 H+ + GTP
  5. E) Glucose + 2GDP + 2 Pi 2Lactate + 2GTP

Answer:  A

Objective:  23.1

Global Outcomes:  GO2

 

11) The citric acid cycle operates only under aerobic conditions because

  1. A) oxygen is a reactant in the citric acid cycle.
  2. B) oxygen is a product of the citric acid cycle.
  3. C) CO2is a product of the citric acid cycle.
  4. D) the NADH and FADH2produced by the citric acid cycle can only be reoxidized by the electron transport chain.
  5. E) the NAD+ and FAD produced by the citric acid cycle can only be reduced by the electron transport chain.

Answer:  D

Objective:  23.1

Global Outcomes:  GO2

 

12) When oxygen is in plentiful supply in the cell, pyruvate is converted to

  1. A) CoA.
  2. B) acetyl CoA.
  3. C) glucose.
  4. D) lactate.
  5. E) fructose.

Answer:  B

Objective:  23.1

Global Outcomes:  GO2

 

13) Which of the three major stages of metabolism includes the citric acid cycle?

  1. A) Stage one
  2. B) Stage two
  3. C) Stage three

Answer:  C

Objective:  23.1

Global Outcomes:  GO2

 

14) The citric acid cycle takes place in the

  1. A) mitochondria.
  2. B) cytosol.
  3. C) cytoplasm.
  4. D) Golgi apparatus.
  5. E) endoplasmic reticulum.

Answer:  A

Objective:  23.1

Global Outcomes:  GO7

 

15) Most of the energy released in the citric acid cycle is used to produce

  1. A) glucose.
  2. B) acetyl CoA.
  3. C) NADH and FADH2.
  4. D) carbon dioxide and water.
  5. E) citric acid.

Answer:  C

Objective:  23.1

Global Outcomes:  GO2

 

16) Another name for the citric acid cycle is

  1. A) electron transport.
  2. B) glycolysis.
  3. C) the tricarboxylic acid (TCA) cycle.
  4. D) glucolysis.
  5. E) the transamination pathway.

Answer:  C

Objective:  23.1

Global Outcomes:  GO7

 

17) Another name for the citric

Write a review

Your Name:


Your Review: Note: HTML is not translated!

Rating: Bad           Good

Enter the code in the box below:



 

Once the order is placed, the order will be delivered to your email less than 24 hours, mostly within 4 hours. 

If you have questions, you can contact us here